C14H23FN2O2S — CID 81435327
4-fluoro-3-methyl-N-propyl-5-(propylaminomethyl)benzenesulfonamide (PubChem CID 81435327) has the molecular formula C14H23FN2O2S and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-propyl-5-(propylaminomethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-propyl-5-(propylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81435327 |
| Molecular Formula | C14H23FN2O2S |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-fluoro-3-methyl-N-propyl-5-(propylaminomethyl)benzenesulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)NCCC)cc(C)c1F |
| InChI | InChI=1S/C14H23FN2O2S/c1-4-6-16-10-12-9-13(8-11(3)14(12)15)20(18,19)17-7-5-2/h8-9,16-17H,4-7,10H2,1-3H3 |
| InChIKey | MPEDOVACXHDDCE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|