C12H18FNO3S — CID 81434541
N-butyl-4-fluoro-3-(hydroxymethyl)-5-methylbenzenesulfonamide (PubChem CID 81434541) has the molecular formula C12H18FNO3S and a molecular weight of 275.34 g/mol. Its IUPAC name is N-butyl-4-fluoro-3-(hydroxymethyl)-5-methylbenzenesulfonamide.
| Compound Name | N-butyl-4-fluoro-3-(hydroxymethyl)-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81434541 |
| Molecular Formula | C12H18FNO3S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-butyl-4-fluoro-3-(hydroxymethyl)-5-methylbenzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cc(C)c(F)c(CO)c1 |
| InChI | InChI=1S/C12H18FNO3S/c1-3-4-5-14-18(16,17)11-6-9(2)12(13)10(7-11)8-15/h6-7,14-15H,3-5,8H2,1-2H3 |
| InChIKey | LMGCSPUFHFFTKV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|