C13H18FNO3S — CID 81435941
N-cyclopentyl-4-fluoro-3-(hydroxymethyl)-5-methylbenzenesulfonamide (PubChem CID 81435941) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is N-cyclopentyl-4-fluoro-3-(hydroxymethyl)-5-methylbenzenesulfonamide.
| Compound Name | N-cyclopentyl-4-fluoro-3-(hydroxymethyl)-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81435941 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-cyclopentyl-4-fluoro-3-(hydroxymethyl)-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCCC2)cc(CO)c1F |
| InChI | InChI=1S/C13H18FNO3S/c1-9-6-12(7-10(8-16)13(9)14)19(17,18)15-11-4-2-3-5-11/h6-7,11,15-16H,2-5,8H2,1H3 |
| InChIKey | VJXWTMJKMJDRPI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |