C12H15BrFN3 — CID 81437582
2-(4-bromo-3-fluorophenyl)-2-[2-(dimethylamino)ethylamino]acetonitrile (PubChem CID 81437582) has the molecular formula C12H15BrFN3 and a molecular weight of 300.18 g/mol. Its IUPAC name is 2-(4-bromo-3-fluorophenyl)-2-[2-(dimethylamino)ethylamino]acetonitrile.
| Compound Name | 2-(4-bromo-3-fluorophenyl)-2-[2-(dimethylamino)ethylamino]acetonitrile |
|---|---|
| PubChem CID | 81437582 |
| Molecular Formula | C12H15BrFN3 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-(4-bromo-3-fluorophenyl)-2-[2-(dimethylamino)ethylamino]acetonitrile |
| SMILES | CN(C)CCNC(C#N)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H15BrFN3/c1-17(2)6-5-16-12(8-15)9-3-4-10(13)11(14)7-9/h3-4,7,12,16H,5-6H2,1-2H3 |
| InChIKey | FDADAYZEHRUMND-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |