C12H13N3O2S — CID 81439609
5-amino-6-[(4-methylthiophen-3-yl)methylamino]pyridine-3-carboxylic acid (PubChem CID 81439609) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 5-amino-6-[(4-methylthiophen-3-yl)methylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-amino-6-[(4-methylthiophen-3-yl)methylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81439609 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 5-amino-6-[(4-methylthiophen-3-yl)methylamino]pyridine-3-carboxylic acid |
| SMILES | Cc1cscc1CNc1ncc(C(=O)O)cc1N |
| InChI | InChI=1S/C12H13N3O2S/c1-7-5-18-6-9(7)4-15-11-10(13)2-8(3-14-11)12(16)17/h2-3,5-6H,4,13H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | VGTOZPBSROTHCK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |