C9H11N3O2 — CID 82469001
5-amino-6-(prop-2-enylamino)pyridine-3-carboxylic acid (PubChem CID 82469001) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 5-amino-6-(prop-2-enylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-amino-6-(prop-2-enylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 82469001 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 5-amino-6-(prop-2-enylamino)pyridine-3-carboxylic acid |
| SMILES | C=CCNc1ncc(C(=O)O)cc1N |
| InChI | InChI=1S/C9H11N3O2/c1-2-3-11-8-7(10)4-6(5-12-8)9(13)14/h2,4-5H,1,3,10H2,(H,11,12)(H,13,14) |
| InChIKey | JFVYQTLVFAOYAS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|