C10H7Cl3N4O2 — CID 81444525
4-(1-chloroethyl)-1-(2,6-dichloro-4-nitrophenyl)triazole (PubChem CID 81444525) has the molecular formula C10H7Cl3N4O2 and a molecular weight of 321.55 g/mol. Its IUPAC name is 4-(1-chloroethyl)-1-(2,6-dichloro-4-nitrophenyl)triazole.
| Compound Name | 4-(1-chloroethyl)-1-(2,6-dichloro-4-nitrophenyl)triazole |
|---|---|
| PubChem CID | 81444525 |
| Molecular Formula | C10H7Cl3N4O2 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 4-(1-chloroethyl)-1-(2,6-dichloro-4-nitrophenyl)triazole |
| SMILES | CC(Cl)c1cn(-c2c(Cl)cc([N+](=O)[O-])cc2Cl)nn1 |
| InChI | InChI=1S/C10H7Cl3N4O2/c1-5(11)9-4-16(15-14-9)10-7(12)2-6(17(18)19)3-8(10)13/h2-5H,1H3 |
| InChIKey | MCTIIRGIDQFOSW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|