C10H7Cl4N3 — CID 81449128
4-(1-chloroethyl)-1-(2,4,6-trichlorophenyl)triazole (PubChem CID 81449128) has the molecular formula C10H7Cl4N3 and a molecular weight of 311.00 g/mol. Its IUPAC name is 4-(1-chloroethyl)-1-(2,4,6-trichlorophenyl)triazole.
| Compound Name | 4-(1-chloroethyl)-1-(2,4,6-trichlorophenyl)triazole |
|---|---|
| PubChem CID | 81449128 |
| Molecular Formula | C10H7Cl4N3 |
| Molecular Weight | 311.00 g/mol |
| Exact Mass | 308.94 |
| IUPAC Name | 4-(1-chloroethyl)-1-(2,4,6-trichlorophenyl)triazole |
| SMILES | CC(Cl)c1cn(-c2c(Cl)cc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C10H7Cl4N3/c1-5(11)9-4-17(16-15-9)10-7(13)2-6(12)3-8(10)14/h2-5H,1H3 |
| InChIKey | YOKKQTICEBWENR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.00 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|