C11H14N2O4 — CID 81445787
4-[(3-hydroxypyridine-4-carbonyl)amino]pentanoic acid (PubChem CID 81445787) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 4-[(3-hydroxypyridine-4-carbonyl)amino]pentanoic acid.
| Compound Name | 4-[(3-hydroxypyridine-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 81445787 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4-[(3-hydroxypyridine-4-carbonyl)amino]pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)c1ccncc1O |
| InChI | InChI=1S/C11H14N2O4/c1-7(2-3-10(15)16)13-11(17)8-4-5-12-6-9(8)14/h4-7,14H,2-3H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | WLBPRPQWWFBTRQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |