C11H16N2O4 — CID 81445583
N-(1,1-dimethoxypropan-2-yl)-3-hydroxypyridine-4-carboxamide (PubChem CID 81445583) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)-3-hydroxypyridine-4-carboxamide.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)-3-hydroxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 81445583 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)-3-hydroxypyridine-4-carboxamide |
| SMILES | COC(OC)C(C)NC(=O)c1ccncc1O |
| InChI | InChI=1S/C11H16N2O4/c1-7(11(16-2)17-3)13-10(15)8-4-5-12-6-9(8)14/h4-7,11,14H,1-3H3,(H,13,15) |
| InChIKey | ZLAZUACBCJEQKT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|