C13H11BrClN5O — CID 81449143
3-[[4-(1-bromoethyl)triazol-1-yl]methyl]-5-(4-chlorophenyl)-1,2,4-oxadiazole (PubChem CID 81449143) has the molecular formula C13H11BrClN5O and a molecular weight of 368.62 g/mol. Its IUPAC name is 3-[[4-(1-bromoethyl)triazol-1-yl]methyl]-5-(4-chlorophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-[[4-(1-bromoethyl)triazol-1-yl]methyl]-5-(4-chlorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 81449143 |
| Molecular Formula | C13H11BrClN5O |
| Molecular Weight | 368.62 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 3-[[4-(1-bromoethyl)triazol-1-yl]methyl]-5-(4-chlorophenyl)-1,2,4-oxadiazole |
| SMILES | CC(Br)c1cn(Cc2noc(-c3ccc(Cl)cc3)n2)nn1 |
| InChI | InChI=1S/C13H11BrClN5O/c1-8(14)11-6-20(19-17-11)7-12-16-13(21-18-12)9-2-4-10(15)5-3-9/h2-6,8H,7H2,1H3 |
| InChIKey | BUZXSASIXFYZHP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|