C13H18Cl2FNO3S — CID 81450839
4-chloro-3-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-5-fluorobenzenesulfonamide (PubChem CID 81450839) has the molecular formula C13H18Cl2FNO3S and a molecular weight of 358.26 g/mol. Its IUPAC name is 4-chloro-3-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-5-fluorobenzenesulfonamide.
| Compound Name | 4-chloro-3-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 81450839 |
| Molecular Formula | C13H18Cl2FNO3S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-chloro-3-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-5-fluorobenzenesulfonamide |
| SMILES | CCOCCN(CC)S(=O)(=O)c1cc(F)c(Cl)c(CCl)c1 |
| InChI | InChI=1S/C13H18Cl2FNO3S/c1-3-17(5-6-20-4-2)21(18,19)11-7-10(9-14)13(15)12(16)8-11/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | NXLWJTQGZCFANW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|