C9H16N2OS — CID 81451810
N-(2-aminocyclopropyl)-2-methylthiolane-2-carboxamide (PubChem CID 81451810) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is N-(2-aminocyclopropyl)-2-methylthiolane-2-carboxamide.
| Compound Name | N-(2-aminocyclopropyl)-2-methylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 81451810 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | N-(2-aminocyclopropyl)-2-methylthiolane-2-carboxamide |
| SMILES | CC1(C(=O)NC2CC2N)CCCS1 |
| InChI | InChI=1S/C9H16N2OS/c1-9(3-2-4-13-9)8(12)11-7-5-6(7)10/h6-7H,2-5,10H2,1H3,(H,11,12) |
| InChIKey | IKLOHFCRFPICSD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |