C15H28N2OS3 — CID 89410571
2-[(1S)-1-(tert-butylsulfanylamino)butyl]-N-cyclopropyl-1,3-dithiolane-2-carboxamide (PubChem CID 89410571) has the molecular formula C15H28N2OS3 and a molecular weight of 348.60 g/mol. Its IUPAC name is 2-[(1S)-1-(tert-butylsulfanylamino)butyl]-N-cyclopropyl-1,3-dithiolane-2-carboxamide.
| Compound Name | 2-[(1S)-1-(tert-butylsulfanylamino)butyl]-N-cyclopropyl-1,3-dithiolane-2-carboxamide |
|---|---|
| PubChem CID | 89410571 |
| Molecular Formula | C15H28N2OS3 |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[(1S)-1-(tert-butylsulfanylamino)butyl]-N-cyclopropyl-1,3-dithiolane-2-carboxamide |
| SMILES | CCC[C@H](NSC(C)(C)C)C1(C(=O)NC2CC2)SCCS1 |
| InChI | InChI=1S/C15H28N2OS3/c1-5-6-12(17-21-14(2,3)4)15(19-9-10-20-15)13(18)16-11-7-8-11/h11-12,17H,5-10H2,1-4H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | CISAZLNJPDCQGJ-LBPRGKRZSA-N |
| XLogP | 3.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|