C11H20N2OS — CID 81452924
2-methyl-N-piperidin-3-ylthiolane-2-carboxamide (PubChem CID 81452924) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 2-methyl-N-piperidin-3-ylthiolane-2-carboxamide.
| Compound Name | 2-methyl-N-piperidin-3-ylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 81452924 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-methyl-N-piperidin-3-ylthiolane-2-carboxamide |
| SMILES | CC1(C(=O)NC2CCCNC2)CCCS1 |
| InChI | InChI=1S/C11H20N2OS/c1-11(5-3-7-15-11)10(14)13-9-4-2-6-12-8-9/h9,12H,2-8H2,1H3,(H,13,14) |
| InChIKey | TZZLCCDBKOCPEF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |