C13H23NOS — CID 115882470
N-(3,3-dimethylcyclopentyl)-2-methylthiolane-2-carboxamide (PubChem CID 115882470) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-2-methylthiolane-2-carboxamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-2-methylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 115882470 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-2-methylthiolane-2-carboxamide |
| SMILES | CC1(C)CCC(NC(=O)C2(C)CCCS2)C1 |
| InChI | InChI=1S/C13H23NOS/c1-12(2)7-5-10(9-12)14-11(15)13(3)6-4-8-16-13/h10H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | YIAOFTAJNQFMFL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |