C13H13ClFN3O2S — CID 81454167
3-(2-chloro-3-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine (PubChem CID 81454167) has the molecular formula C13H13ClFN3O2S and a molecular weight of 329.78 g/mol. Its IUPAC name is 3-(2-chloro-3-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine.
| Compound Name | 3-(2-chloro-3-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 81454167 |
| Molecular Formula | C13H13ClFN3O2S |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3-(2-chloro-3-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine |
| SMILES | Nc1cc(-c2cccc(F)c2Cl)nn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H13ClFN3O2S/c14-13-9(2-1-3-10(13)15)11-6-12(16)18(17-11)8-4-5-21(19,20)7-8/h1-3,6,8H,4-5,7,16H2 |
| InChIKey | RELBEEUKIKXOJN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |