C8H8ClFN2O3S — CID 81454798
2-chloro-3-fluoro-N-methyl-5-sulfamoylbenzamide (PubChem CID 81454798) has the molecular formula C8H8ClFN2O3S and a molecular weight of 266.68 g/mol. Its IUPAC name is 2-chloro-3-fluoro-N-methyl-5-sulfamoylbenzamide.
| Compound Name | 2-chloro-3-fluoro-N-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 81454798 |
| Molecular Formula | C8H8ClFN2O3S |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 2-chloro-3-fluoro-N-methyl-5-sulfamoylbenzamide |
| SMILES | CNC(=O)c1cc(S(N)(=O)=O)cc(F)c1Cl |
| InChI | InChI=1S/C8H8ClFN2O3S/c1-12-8(13)5-2-4(16(11,14)15)3-6(10)7(5)9/h2-3H,1H3,(H,12,13)(H2,11,14,15) |
| InChIKey | KKKVGVHQWOASHA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |