C13H20ClFN2O2S — CID 81457009
4-chloro-N-ethyl-3-fluoro-5-(methylaminomethyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 81457009) has the molecular formula C13H20ClFN2O2S and a molecular weight of 322.83 g/mol. Its IUPAC name is 4-chloro-N-ethyl-3-fluoro-5-(methylaminomethyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-chloro-N-ethyl-3-fluoro-5-(methylaminomethyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 81457009 |
| Molecular Formula | C13H20ClFN2O2S |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-chloro-N-ethyl-3-fluoro-5-(methylaminomethyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CCN(C(C)C)S(=O)(=O)c1cc(F)c(Cl)c(CNC)c1 |
| InChI | InChI=1S/C13H20ClFN2O2S/c1-5-17(9(2)3)20(18,19)11-6-10(8-16-4)13(14)12(15)7-11/h6-7,9,16H,5,8H2,1-4H3 |
| InChIKey | YUKJYQYOOKFRCE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |