C15H17F3N2O — CID 81460123
3-(3-aminoprop-1-ynyl)-N-ethyl-4-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 81460123) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-ethyl-4-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-ethyl-4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 81460123 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-ethyl-4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCN(CC(F)(F)F)C(=O)c1ccc(C)c(C#CCN)c1 |
| InChI | InChI=1S/C15H17F3N2O/c1-3-20(10-15(16,17)18)14(21)13-7-6-11(2)12(9-13)5-4-8-19/h6-7,9H,3,8,10,19H2,1-2H3 |
| InChIKey | DCACEKANPXONLC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|