C13H18F2N2O — CID 81465818
N-[2-(difluoromethoxy)phenyl]-1,5-dimethylpyrrolidin-3-amine (PubChem CID 81465818) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-1,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-1,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 81465818 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-1,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1CC(Nc2ccccc2OC(F)F)CN1C |
| InChI | InChI=1S/C13H18F2N2O/c1-9-7-10(8-17(9)2)16-11-5-3-4-6-12(11)18-13(14)15/h3-6,9-10,13,16H,7-8H2,1-2H3 |
| InChIKey | YOMMWFLCPMTGIK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |