C13H15FN2O — CID 81466790
N-(5-amino-2-fluorophenyl)bicyclo[3.1.0]hexane-6-carboxamide (PubChem CID 81466790) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)bicyclo[3.1.0]hexane-6-carboxamide.
| Compound Name | N-(5-amino-2-fluorophenyl)bicyclo[3.1.0]hexane-6-carboxamide |
|---|---|
| PubChem CID | 81466790 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)bicyclo[3.1.0]hexane-6-carboxamide |
| SMILES | Nc1ccc(F)c(NC(=O)C2C3CCCC32)c1 |
| InChI | InChI=1S/C13H15FN2O/c14-10-5-4-7(15)6-11(10)16-13(17)12-8-2-1-3-9(8)12/h4-6,8-9,12H,1-3,15H2,(H,16,17) |
| InChIKey | GAILOKBSYGBPIZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|