C14H19FN2O3S — CID 63119729
N-(5-amino-2-fluorophenyl)-2-(cyclopentylmethylsulfonyl)acetamide (PubChem CID 63119729) has the molecular formula C14H19FN2O3S and a molecular weight of 314.38 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-2-(cyclopentylmethylsulfonyl)acetamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-2-(cyclopentylmethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 63119729 |
| Molecular Formula | C14H19FN2O3S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-2-(cyclopentylmethylsulfonyl)acetamide |
| SMILES | Nc1ccc(F)c(NC(=O)CS(=O)(=O)CC2CCCC2)c1 |
| InChI | InChI=1S/C14H19FN2O3S/c15-12-6-5-11(16)7-13(12)17-14(18)9-21(19,20)8-10-3-1-2-4-10/h5-7,10H,1-4,8-9,16H2,(H,17,18) |
| InChIKey | BTLCYPBDKCVOPU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|