About 3-bromo-4-methylbenzoyl azide
3-bromo-4-methylbenzoyl azide (PubChem CID 81472134) has the molecular formula C8H6BrN3O
and a molecular weight of 240.06 g/mol. Its IUPAC name is 3-bromo-4-methylbenzoyl azide.
Molecular Properties
| Compound Name | 3-bromo-4-methylbenzoyl azide |
| PubChem CID | 81472134 |
| Molecular Formula | C8H6BrN3O |
| Molecular Weight | 240.06 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 3-bromo-4-methylbenzoyl azide |
| SMILES | Cc1ccc(C(=O)N=[N+]=[N-])cc1Br |
| InChI | InChI=1S/C8H6BrN3O/c1-5-2-3-6(4-7(5)9)8(13)11-12-10/h2-4H,1H3 |
| InChIKey | PCAKUEMFLJPKFE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.06 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-methylbenzoyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-methylbenzoyl azide?
The IUPAC name of 3-bromo-4-methylbenzoyl azide (CID 81472134) is 3-bromo-4-methylbenzoyl azide.
What is the SMILES notation for 3-bromo-4-methylbenzoyl azide?
The canonical SMILES for 3-bromo-4-methylbenzoyl azide is Cc1ccc(C(=O)N=[N+]=[N-])cc1Br.
What is the InChIKey of 3-bromo-4-methylbenzoyl azide?
The InChIKey is PCAKUEMFLJPKFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3O/c1-5-2-3-6(4-7(5)9)8(13)11-12-10/h2-4H,1H3.
What are the key properties of 3-bromo-4-methylbenzoyl azide?
3-bromo-4-methylbenzoyl azide has a molecular weight of 240.06 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-methylbenzoyl azide is sourced from PubChem (CID 81472134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).