C14H15ClFNO3S — CID 81481969
3-(2-azabicyclo[2.2.1]heptane-2-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride (PubChem CID 81481969) has the molecular formula C14H15ClFNO3S and a molecular weight of 331.80 g/mol. Its IUPAC name is 3-(2-azabicyclo[2.2.1]heptane-2-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride.
| Compound Name | 3-(2-azabicyclo[2.2.1]heptane-2-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 81481969 |
| Molecular Formula | C14H15ClFNO3S |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 3-(2-azabicyclo[2.2.1]heptane-2-carbonyl)-4-fluoro-5-methylbenzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)cc(C(=O)N2CC3CCC2C3)c1F |
| InChI | InChI=1S/C14H15ClFNO3S/c1-8-4-11(21(15,19)20)6-12(13(8)16)14(18)17-7-9-2-3-10(17)5-9/h4,6,9-10H,2-3,5,7H2,1H3 |
| InChIKey | OORCPDDHZNGQGZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |