C13H15FN4O — CID 81488809
4-(2-fluorophenyl)-3-piperidin-3-yl-1H-1,2,4-triazol-5-one (PubChem CID 81488809) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-3-piperidin-3-yl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-(2-fluorophenyl)-3-piperidin-3-yl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 81488809 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-(2-fluorophenyl)-3-piperidin-3-yl-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(C2CCCNC2)n1-c1ccccc1F |
| InChI | InChI=1S/C13H15FN4O/c14-10-5-1-2-6-11(10)18-12(16-17-13(18)19)9-4-3-7-15-8-9/h1-2,5-6,9,15H,3-4,7-8H2,(H,17,19) |
| InChIKey | ORBIJUCMAYRHOR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |