C15H17FN2O3 — CID 81494829
ethyl 1-[4-fluoro-2-(1-hydroxyethyl)-5-methylphenyl]pyrazole-4-carboxylate (PubChem CID 81494829) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is ethyl 1-[4-fluoro-2-(1-hydroxyethyl)-5-methylphenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[4-fluoro-2-(1-hydroxyethyl)-5-methylphenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 81494829 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | ethyl 1-[4-fluoro-2-(1-hydroxyethyl)-5-methylphenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cc(C)c(F)cc2C(C)O)c1 |
| InChI | InChI=1S/C15H17FN2O3/c1-4-21-15(20)11-7-17-18(8-11)14-5-9(2)13(16)6-12(14)10(3)19/h5-8,10,19H,4H2,1-3H3 |
| InChIKey | NHUHEFXKBGTCHG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |