C13H10FN3O4 — CID 81495087
3-fluoro-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]benzoic acid (PubChem CID 81495087) has the molecular formula C13H10FN3O4 and a molecular weight of 291.24 g/mol. Its IUPAC name is 3-fluoro-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]benzoic acid.
| Compound Name | 3-fluoro-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 81495087 |
| Molecular Formula | C13H10FN3O4 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-fluoro-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(Cn1cccnc1=O)Nc1c(F)cccc1C(=O)O |
| InChI | InChI=1S/C13H10FN3O4/c14-9-4-1-3-8(12(19)20)11(9)16-10(18)7-17-6-2-5-15-13(17)21/h1-6H,7H2,(H,16,18)(H,19,20) |
| InChIKey | AIHGNFQIWIWZLB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |