C16H19Cl2N3 — CID 81495126
N-[[2-(3,4-dichlorophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-1-amine (PubChem CID 81495126) has the molecular formula C16H19Cl2N3 and a molecular weight of 324.26 g/mol. Its IUPAC name is N-[[2-(3,4-dichlorophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3,4-dichlorophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81495126 |
| Molecular Formula | C16H19Cl2N3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[[2-(3,4-dichlorophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1c(C)nc(-c2ccc(Cl)c(Cl)c2)nc1C |
| InChI | InChI=1S/C16H19Cl2N3/c1-4-7-19-9-13-10(2)20-16(21-11(13)3)12-5-6-14(17)15(18)8-12/h5-6,8,19H,4,7,9H2,1-3H3 |
| InChIKey | MTSXJAZORKQPHZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|