C16H16N2O2S — CID 81495197
methyl 3-(6-benzylimidazo[2,1-b][1,3]thiazol-3-yl)propanoate (PubChem CID 81495197) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is methyl 3-(6-benzylimidazo[2,1-b][1,3]thiazol-3-yl)propanoate.
| Compound Name | methyl 3-(6-benzylimidazo[2,1-b][1,3]thiazol-3-yl)propanoate |
|---|---|
| PubChem CID | 81495197 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | methyl 3-(6-benzylimidazo[2,1-b][1,3]thiazol-3-yl)propanoate |
| SMILES | COC(=O)CCc1csc2nc(Cc3ccccc3)cn12 |
| InChI | InChI=1S/C16H16N2O2S/c1-20-15(19)8-7-14-11-21-16-17-13(10-18(14)16)9-12-5-3-2-4-6-12/h2-6,10-11H,7-9H2,1H3 |
| InChIKey | OYBCLXVOQZJNDX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |