C15H15BrN2O3 — CID 81495580
(2S)-2-amino-N-(3-bromo-2-hydroxyphenyl)-3-(4-hydroxyphenyl)propanamide (PubChem CID 81495580) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-bromo-2-hydroxyphenyl)-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-(3-bromo-2-hydroxyphenyl)-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 81495580 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | (2S)-2-amino-N-(3-bromo-2-hydroxyphenyl)-3-(4-hydroxyphenyl)propanamide |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)Nc1cccc(Br)c1O |
| InChI | InChI=1S/C15H15BrN2O3/c16-11-2-1-3-13(14(11)20)18-15(21)12(17)8-9-4-6-10(19)7-5-9/h1-7,12,19-20H,8,17H2,(H,18,21)/t12-/m0/s1 |
| InChIKey | KBAKOSYMMZRTOA-LBPRGKRZSA-N |
| XLogP | 2.37 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|