C16H16BrNO5 — CID 88841213
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;3-bromo-2-hydroxybenzaldehyde (PubChem CID 88841213) has the molecular formula C16H16BrNO5 and a molecular weight of 382.21 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;3-bromo-2-hydroxybenzaldehyde.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;3-bromo-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 88841213 |
| Molecular Formula | C16H16BrNO5 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;3-bromo-2-hydroxybenzaldehyde |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)O.O=Cc1cccc(Br)c1O |
| InChI | InChI=1S/C9H11NO3.C7H5BrO2/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;8-6-3-1-2-5(4-9)7(6)10/h1-4,8,11H,5,10H2,(H,12,13);1-4,10H/t8-;/m0./s1 |
| InChIKey | XIEOKEQJLVJLCP-QRPNPIFTSA-N |
| XLogP | 2.31 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|