C5H8N2S — CID 817030
N,4-dimethyl-1,3-thiazol-2-amine (PubChem CID 817030) has the molecular formula C5H8N2S and a molecular weight of 128.20 g/mol. Its IUPAC name is N,4-dimethyl-1,3-thiazol-2-amine.
| Compound Name | N,4-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 817030 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | N,4-dimethyl-1,3-thiazol-2-amine |
| SMILES | CNc1nc(C)cs1 |
| InChI | InChI=1S/C5H8N2S/c1-4-3-8-5(6-2)7-4/h3H,1-2H3,(H,6,7) |
| InChIKey | DGBNDUXTMUGNGM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |