C9H12ClNO — CID 819992
2-(chloromethyl)-4-methoxy-3,5-dimethylpyridine (PubChem CID 819992) has the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. Its IUPAC name is 2-(chloromethyl)-4-methoxy-3,5-dimethylpyridine.
| Compound Name | 2-(chloromethyl)-4-methoxy-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 819992 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-(chloromethyl)-4-methoxy-3,5-dimethylpyridine |
| SMILES | COc1c(C)cnc(CCl)c1C |
| InChI | InChI=1S/C9H12ClNO/c1-6-5-11-8(4-10)7(2)9(6)12-3/h5H,4H2,1-3H3 |
| InChIKey | SRKVJDYNPSMHJM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|