C15H23NO3 — CID 82001926
(NE)-N-[1-[4-methoxy-2-(2-methylpentoxy)phenyl]ethylidene]hydroxylamine (PubChem CID 82001926) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (NE)-N-[1-[4-methoxy-2-(2-methylpentoxy)phenyl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[4-methoxy-2-(2-methylpentoxy)phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 82001926 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (NE)-N-[1-[4-methoxy-2-(2-methylpentoxy)phenyl]ethylidene]hydroxylamine |
| SMILES | CCCC(C)COc1cc(OC)ccc1/C(C)=N/O |
| InChI | InChI=1S/C15H23NO3/c1-5-6-11(2)10-19-15-9-13(18-4)7-8-14(15)12(3)16-17/h7-9,11,17H,5-6,10H2,1-4H3/b16-12+ |
| InChIKey | PPLBJHPZVIDTNQ-FOWTUZBSSA-N |
| XLogP | 3.71 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|