C11H13F2NO3 — CID 82001759
(NE)-N-[1-[2-(2,2-difluoroethoxy)-4-methoxyphenyl]ethylidene]hydroxylamine (PubChem CID 82001759) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is (NE)-N-[1-[2-(2,2-difluoroethoxy)-4-methoxyphenyl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[2-(2,2-difluoroethoxy)-4-methoxyphenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 82001759 |
| Molecular Formula | C11H13F2NO3 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (NE)-N-[1-[2-(2,2-difluoroethoxy)-4-methoxyphenyl]ethylidene]hydroxylamine |
| SMILES | COc1ccc(/C(C)=N/O)c(OCC(F)F)c1 |
| InChI | InChI=1S/C11H13F2NO3/c1-7(14-15)9-4-3-8(16-2)5-10(9)17-6-11(12)13/h3-5,11,15H,6H2,1-2H3/b14-7+ |
| InChIKey | NHPMEUKOYDCKQA-VGOFMYFVSA-N |
| XLogP | 2.54 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|