C12H17N3O2S — CID 82002403
3-(2-amino-N-methyl-3-methylsulfonylanilino)-2-methylpropanenitrile (PubChem CID 82002403) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-(2-amino-N-methyl-3-methylsulfonylanilino)-2-methylpropanenitrile.
| Compound Name | 3-(2-amino-N-methyl-3-methylsulfonylanilino)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 82002403 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-(2-amino-N-methyl-3-methylsulfonylanilino)-2-methylpropanenitrile |
| SMILES | CC(C#N)CN(C)c1cccc(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C12H17N3O2S/c1-9(7-13)8-15(2)10-5-4-6-11(12(10)14)18(3,16)17/h4-6,9H,8,14H2,1-3H3 |
| InChIKey | KDTAMYMOXUPAAS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|