C13H22N2O3S — CID 82948630
1-N-(2-methoxyethyl)-3-methylsulfonyl-1-N-propan-2-ylbenzene-1,2-diamine (PubChem CID 82948630) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-N-(2-methoxyethyl)-3-methylsulfonyl-1-N-propan-2-ylbenzene-1,2-diamine.
| Compound Name | 1-N-(2-methoxyethyl)-3-methylsulfonyl-1-N-propan-2-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 82948630 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-N-(2-methoxyethyl)-3-methylsulfonyl-1-N-propan-2-ylbenzene-1,2-diamine |
| SMILES | COCCN(c1cccc(S(C)(=O)=O)c1N)C(C)C |
| InChI | InChI=1S/C13H22N2O3S/c1-10(2)15(8-9-18-3)11-6-5-7-12(13(11)14)19(4,16)17/h5-7,10H,8-9,14H2,1-4H3 |
| InChIKey | QDWOUPCNRQUAMT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|