C13H10Cl2N2S — CID 82004288
5,6-dichloro-2-(4,5-dimethylthiophen-2-yl)-1H-benzimidazole (PubChem CID 82004288) has the molecular formula C13H10Cl2N2S and a molecular weight of 297.21 g/mol. Its IUPAC name is 5,6-dichloro-2-(4,5-dimethylthiophen-2-yl)-1H-benzimidazole.
| Compound Name | 5,6-dichloro-2-(4,5-dimethylthiophen-2-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 82004288 |
| Molecular Formula | C13H10Cl2N2S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 5,6-dichloro-2-(4,5-dimethylthiophen-2-yl)-1H-benzimidazole |
| SMILES | Cc1cc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)sc1C |
| InChI | InChI=1S/C13H10Cl2N2S/c1-6-3-12(18-7(6)2)13-16-10-4-8(14)9(15)5-11(10)17-13/h3-5H,1-2H3,(H,16,17) |
| InChIKey | RAWKTYRWVFZCPF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |