C9H19F2NO — CID 82004961
5-(2,2-difluoroethoxy)-N-ethylpentan-2-amine (PubChem CID 82004961) has the molecular formula C9H19F2NO and a molecular weight of 195.25 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-N-ethylpentan-2-amine.
| Compound Name | 5-(2,2-difluoroethoxy)-N-ethylpentan-2-amine |
|---|---|
| PubChem CID | 82004961 |
| Molecular Formula | C9H19F2NO |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-N-ethylpentan-2-amine |
| SMILES | CCNC(C)CCCOCC(F)F |
| InChI | InChI=1S/C9H19F2NO/c1-3-12-8(2)5-4-6-13-7-9(10)11/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | DUXCSDKZUVCQGW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|