C13H19F2NO2 — CID 82005062
2-(2,2-difluoroethoxy)-1-(2-ethoxyphenyl)-N-methylethanamine (PubChem CID 82005062) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-1-(2-ethoxyphenyl)-N-methylethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-1-(2-ethoxyphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 82005062 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-1-(2-ethoxyphenyl)-N-methylethanamine |
| SMILES | CCOc1ccccc1C(COCC(F)F)NC |
| InChI | InChI=1S/C13H19F2NO2/c1-3-18-12-7-5-4-6-10(12)11(16-2)8-17-9-13(14)15/h4-7,11,13,16H,3,8-9H2,1-2H3 |
| InChIKey | RQCUBSYWFFHLHS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |