C11H16F2N2O — CID 82005131
1-(2,2-difluoroethoxy)-1-pyridin-2-ylbutan-2-amine (PubChem CID 82005131) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-1-pyridin-2-ylbutan-2-amine.
| Compound Name | 1-(2,2-difluoroethoxy)-1-pyridin-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 82005131 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-1-pyridin-2-ylbutan-2-amine |
| SMILES | CCC(N)C(OCC(F)F)c1ccccn1 |
| InChI | InChI=1S/C11H16F2N2O/c1-2-8(14)11(16-7-10(12)13)9-5-3-4-6-15-9/h3-6,8,10-11H,2,7,14H2,1H3 |
| InChIKey | KQQCIISSXZLRSV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |