C13H7Cl2IN2O2S — CID 82005738
2-[5,6-dichloro-2-(5-iodothiophen-3-yl)benzimidazol-1-yl]acetic acid (PubChem CID 82005738) has the molecular formula C13H7Cl2IN2O2S and a molecular weight of 453.09 g/mol. Its IUPAC name is 2-[5,6-dichloro-2-(5-iodothiophen-3-yl)benzimidazol-1-yl]acetic acid.
| Compound Name | 2-[5,6-dichloro-2-(5-iodothiophen-3-yl)benzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 82005738 |
| Molecular Formula | C13H7Cl2IN2O2S |
| Molecular Weight | 453.09 g/mol |
| Exact Mass | 451.87 |
| IUPAC Name | 2-[5,6-dichloro-2-(5-iodothiophen-3-yl)benzimidazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(-c2csc(I)c2)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C13H7Cl2IN2O2S/c14-7-2-9-10(3-8(7)15)18(4-12(19)20)13(17-9)6-1-11(16)21-5-6/h1-3,5H,4H2,(H,19,20) |
| InChIKey | TUXXHBCZTZGYAV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.09 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|