About 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine
1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine (PubChem CID 82005877) has the molecular formula C9H17F2NO2
and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine |
| PubChem CID | 82005877 |
| Molecular Formula | C9H17F2NO2 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine |
| SMILES | CNCC1CCC(COCC(F)F)O1 |
| InChI | InChI=1S/C9H17F2NO2/c1-12-4-7-2-3-8(14-7)5-13-6-9(10)11/h7-9,12H,2-6H2,1H3 |
| InChIKey | AFFVJPWIHKLRNK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine?
The IUPAC name of 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine (CID 82005877) is 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine?
The canonical SMILES for 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine is CNCC1CCC(COCC(F)F)O1.
What is the InChIKey of 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine?
The InChIKey is AFFVJPWIHKLRNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO2/c1-12-4-7-2-3-8(14-7)5-13-6-9(10)11/h7-9,12H,2-6H2,1H3.
What are the key properties of 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine?
1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine has a molecular weight of 209.24 g/mol, XLogP of 1.04, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,2-difluoroethoxymethyl)oxolan-2-yl]-N-methylmethanamine is sourced from PubChem (CID 82005877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).