C10H19F2NO3 — CID 82006587
ethyl 2-amino-4-(2,2-difluoroethoxy)-2-methylpentanoate (PubChem CID 82006587) has the molecular formula C10H19F2NO3 and a molecular weight of 239.26 g/mol. Its IUPAC name is ethyl 2-amino-4-(2,2-difluoroethoxy)-2-methylpentanoate.
| Compound Name | ethyl 2-amino-4-(2,2-difluoroethoxy)-2-methylpentanoate |
|---|---|
| PubChem CID | 82006587 |
| Molecular Formula | C10H19F2NO3 |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | ethyl 2-amino-4-(2,2-difluoroethoxy)-2-methylpentanoate |
| SMILES | CCOC(=O)C(C)(N)CC(C)OCC(F)F |
| InChI | InChI=1S/C10H19F2NO3/c1-4-15-9(14)10(3,13)5-7(2)16-6-8(11)12/h7-8H,4-6,13H2,1-3H3 |
| InChIKey | PZQBJSCGAKDCQF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |