C10H15ClF2O — CID 82009453
3-chloro-1-(2,2-difluoroethoxy)spiro[3.4]octane (PubChem CID 82009453) has the molecular formula C10H15ClF2O and a molecular weight of 224.68 g/mol. Its IUPAC name is 3-chloro-1-(2,2-difluoroethoxy)spiro[3.4]octane.
| Compound Name | 3-chloro-1-(2,2-difluoroethoxy)spiro[3.4]octane |
|---|---|
| PubChem CID | 82009453 |
| Molecular Formula | C10H15ClF2O |
| Molecular Weight | 224.68 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-chloro-1-(2,2-difluoroethoxy)spiro[3.4]octane |
| SMILES | FC(F)COC1CC(Cl)C12CCCC2 |
| InChI | InChI=1S/C10H15ClF2O/c11-7-5-8(14-6-9(12)13)10(7)3-1-2-4-10/h7-9H,1-6H2 |
| InChIKey | HCFQZPQSHQVUPO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.68 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|