C10H17ClF2O — CID 82009791
2-chloro-4-(2,2-difluoroethoxy)-1,1-diethylcyclobutane (PubChem CID 82009791) has the molecular formula C10H17ClF2O and a molecular weight of 226.69 g/mol. Its IUPAC name is 2-chloro-4-(2,2-difluoroethoxy)-1,1-diethylcyclobutane.
| Compound Name | 2-chloro-4-(2,2-difluoroethoxy)-1,1-diethylcyclobutane |
|---|---|
| PubChem CID | 82009791 |
| Molecular Formula | C10H17ClF2O |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-chloro-4-(2,2-difluoroethoxy)-1,1-diethylcyclobutane |
| SMILES | CCC1(CC)C(Cl)CC1OCC(F)F |
| InChI | InChI=1S/C10H17ClF2O/c1-3-10(4-2)7(11)5-8(10)14-6-9(12)13/h7-9H,3-6H2,1-2H3 |
| InChIKey | HQQUELUJYIUWQC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|