C13H14BrF3N2O — CID 82009735
6-(1-bromo-4,4,4-trifluorobutyl)-3-methyl-1,4-dihydroquinazolin-2-one (PubChem CID 82009735) has the molecular formula C13H14BrF3N2O and a molecular weight of 351.17 g/mol. Its IUPAC name is 6-(1-bromo-4,4,4-trifluorobutyl)-3-methyl-1,4-dihydroquinazolin-2-one.
| Compound Name | 6-(1-bromo-4,4,4-trifluorobutyl)-3-methyl-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 82009735 |
| Molecular Formula | C13H14BrF3N2O |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 6-(1-bromo-4,4,4-trifluorobutyl)-3-methyl-1,4-dihydroquinazolin-2-one |
| SMILES | CN1Cc2cc(C(Br)CCC(F)(F)F)ccc2NC1=O |
| InChI | InChI=1S/C13H14BrF3N2O/c1-19-7-9-6-8(2-3-11(9)18-12(19)20)10(14)4-5-13(15,16)17/h2-3,6,10H,4-5,7H2,1H3,(H,18,20) |
| InChIKey | FFDLCZUZDYJYQJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|