C14H20N4O2 — CID 82010210
5-amino-5-(3-methyl-2-oxo-1,4-dihydroquinazolin-6-yl)pentanamide (PubChem CID 82010210) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-amino-5-(3-methyl-2-oxo-1,4-dihydroquinazolin-6-yl)pentanamide.
| Compound Name | 5-amino-5-(3-methyl-2-oxo-1,4-dihydroquinazolin-6-yl)pentanamide |
|---|---|
| PubChem CID | 82010210 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 5-amino-5-(3-methyl-2-oxo-1,4-dihydroquinazolin-6-yl)pentanamide |
| SMILES | CN1Cc2cc(C(N)CCCC(N)=O)ccc2NC1=O |
| InChI | InChI=1S/C14H20N4O2/c1-18-8-10-7-9(5-6-12(10)17-14(18)20)11(15)3-2-4-13(16)19/h5-7,11H,2-4,8,15H2,1H3,(H2,16,19)(H,17,20) |
| InChIKey | QTTPYXIOHGPMEQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |