C4H8F2OS — CID 82010156
2-(2,2-difluoroethoxy)ethanethiol (PubChem CID 82010156) has the molecular formula C4H8F2OS and a molecular weight of 142.17 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)ethanethiol.
| Compound Name | 2-(2,2-difluoroethoxy)ethanethiol |
|---|---|
| PubChem CID | 82010156 |
| Molecular Formula | C4H8F2OS |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 2-(2,2-difluoroethoxy)ethanethiol |
| SMILES | FC(F)COCCS |
| InChI | InChI=1S/C4H8F2OS/c5-4(6)3-7-1-2-8/h4,8H,1-3H2 |
| InChIKey | VHNHRCUXBLSAIZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|